C24H35NO8 — CID 102266119
cyclohexyl (1S,2R,6R,8R,9S,10R)-9-(cyclohexylcarbamoyl)-4,4-dimethyl-11-oxo-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecane-10-carboxylate (PubChem CID 102266119) has the molecular formula C24H35NO8 and a molecular weight of 465.54 g/mol. Its IUPAC name is cyclohexyl (1S,2R,6R,8R,9S,10R)-9-(cyclohexylcarbamoyl)-4,4-dimethyl-11-oxo-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecane-10-carboxylate.
| Compound Name | cyclohexyl (1S,2R,6R,8R,9S,10R)-9-(cyclohexylcarbamoyl)-4,4-dimethyl-11-oxo-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecane-10-carboxylate |
|---|---|
| PubChem CID | 102266119 |
| Molecular Formula | C24H35NO8 |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | cyclohexyl (1S,2R,6R,8R,9S,10R)-9-(cyclohexylcarbamoyl)-4,4-dimethyl-11-oxo-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecane-10-carboxylate |
| SMILES | CC1(C)O[C@H]2O[C@H]3[C@H](OC(=O)[C@@H](C(=O)OC4CCCCC4)[C@@H]3C(=O)NC3CCCCC3)[C@H]2O1 |
| InChI | InChI=1S/C24H35NO8/c1-24(2)32-19-18-17(31-23(19)33-24)15(20(26)25-13-9-5-3-6-10-13)16(22(28)30-18)21(27)29-14-11-7-4-8-12-14/h13-19,23H,3-12H2,1-2H3,(H,25,26)/t15-,16+,17+,18-,19+,23+/m0/s1 |
| InChIKey | FDAZNMPIWHKPBU-XSCAQNHYSA-N |
| XLogP | 2.35 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|