About 2,2,2-trichloroethyl (1R)-2-oxo-1-prop-2-enylcyclopentane-1-carboxylate
2,2,2-trichloroethyl (1R)-2-oxo-1-prop-2-enylcyclopentane-1-carboxylate (PubChem CID 102266946) has the molecular formula C11H13Cl3O3
and a molecular weight of 299.58 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (1R)-2-oxo-1-prop-2-enylcyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | 2,2,2-trichloroethyl (1R)-2-oxo-1-prop-2-enylcyclopentane-1-carboxylate |
| PubChem CID | 102266946 |
| Molecular Formula | C11H13Cl3O3 |
| Molecular Weight | 299.58 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 2,2,2-trichloroethyl (1R)-2-oxo-1-prop-2-enylcyclopentane-1-carboxylate |
| SMILES | C=CC[C@]1(C(=O)OCC(Cl)(Cl)Cl)CCCC1=O |
| InChI | InChI=1S/C11H13Cl3O3/c1-2-5-10(6-3-4-8(10)15)9(16)17-7-11(12,13)14/h2H,1,3-7H2/t10-/m0/s1 |
| InChIKey | DIIADDUIUXKFOK-JTQLQIEISA-N |
| XLogP | 3.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.58 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trichloroethyl (1R)-2-oxo-1-prop-2-enylcyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trichloroethyl (1R)-2-oxo-1-prop-2-enylcyclopentane-1-carboxylate?
The IUPAC name of 2,2,2-trichloroethyl (1R)-2-oxo-1-prop-2-enylcyclopentane-1-carboxylate (CID 102266946) is 2,2,2-trichloroethyl (1R)-2-oxo-1-prop-2-enylcyclopentane-1-carboxylate.
What is the SMILES notation for 2,2,2-trichloroethyl (1R)-2-oxo-1-prop-2-enylcyclopentane-1-carboxylate?
The canonical SMILES for 2,2,2-trichloroethyl (1R)-2-oxo-1-prop-2-enylcyclopentane-1-carboxylate is C=CC[C@]1(C(=O)OCC(Cl)(Cl)Cl)CCCC1=O.
What is the InChIKey of 2,2,2-trichloroethyl (1R)-2-oxo-1-prop-2-enylcyclopentane-1-carboxylate?
The InChIKey is DIIADDUIUXKFOK-JTQLQIEISA-N. The full InChI is InChI=1S/C11H13Cl3O3/c1-2-5-10(6-3-4-8(10)15)9(16)17-7-11(12,13)14/h2H,1,3-7H2/t10-/m0/s1.
What are the key properties of 2,2,2-trichloroethyl (1R)-2-oxo-1-prop-2-enylcyclopentane-1-carboxylate?
2,2,2-trichloroethyl (1R)-2-oxo-1-prop-2-enylcyclopentane-1-carboxylate has a molecular weight of 299.58 g/mol, XLogP of 3.22, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trichloroethyl (1R)-2-oxo-1-prop-2-enylcyclopentane-1-carboxylate is sourced from PubChem (CID 102266946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).