C21H21Br4Si+ — CID 102267189
2-[3,5-dibromo-4-[(3,5-dibromo-2,4,6-trimethylcyclohexa-2,5-dien-1-ylidene)methylidene]cyclohexa-2,5-dien-1-ylidene]ethenyl-trimethylsilane (PubChem CID 102267189) has the molecular formula C21H21Br4Si+ and a molecular weight of 621.10 g/mol. Its IUPAC name is 2-[3,5-dibromo-4-[(3,5-dibromo-2,4,6-trimethylcyclohexa-2,5-dien-1-ylidene)methylidene]cyclohexa-2,5-dien-1-ylidene]ethenyl-trimethylsilane.
| Compound Name | 2-[3,5-dibromo-4-[(3,5-dibromo-2,4,6-trimethylcyclohexa-2,5-dien-1-ylidene)methylidene]cyclohexa-2,5-dien-1-ylidene]ethenyl-trimethylsilane |
|---|---|
| PubChem CID | 102267189 |
| Molecular Formula | C21H21Br4Si+ |
| Molecular Weight | 621.10 g/mol |
| Exact Mass | 616.81 |
| IUPAC Name | 2-[3,5-dibromo-4-[(3,5-dibromo-2,4,6-trimethylcyclohexa-2,5-dien-1-ylidene)methylidene]cyclohexa-2,5-dien-1-ylidene]ethenyl-trimethylsilane |
| SMILES | CC1=C(Br)[C+](C)C(Br)=C(C)C1=C=c1c(Br)cc(=C=C[Si](C)(C)C)cc1Br |
| InChI | InChI=1S/C21H21Br4Si/c1-12-16(13(2)21(25)14(3)20(12)24)11-17-18(22)9-15(10-19(17)23)7-8-26(4,5)6/h8-10H,1-6H3/q+1 |
| InChIKey | PGMXPZYECPWJIJ-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.10 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|