C32H26O2S4 — CID 102267885
2'-(2-spiro[1,3-dithiolane-2,9'-fluorene]-2'-yloxyethoxy)spiro[1,3-dithiolane-2,9'-fluorene] (PubChem CID 102267885) has the molecular formula C32H26O2S4 and a molecular weight of 570.83 g/mol. Its IUPAC name is 2'-(2-spiro[1,3-dithiolane-2,9'-fluorene]-2'-yloxyethoxy)spiro[1,3-dithiolane-2,9'-fluorene].
| Compound Name | 2'-(2-spiro[1,3-dithiolane-2,9'-fluorene]-2'-yloxyethoxy)spiro[1,3-dithiolane-2,9'-fluorene] |
|---|---|
| PubChem CID | 102267885 |
| Molecular Formula | C32H26O2S4 |
| Molecular Weight | 570.83 g/mol |
| Exact Mass | 570.08 |
| IUPAC Name | 2'-(2-spiro[1,3-dithiolane-2,9'-fluorene]-2'-yloxyethoxy)spiro[1,3-dithiolane-2,9'-fluorene] |
| SMILES | c1ccc2c(c1)-c1ccc(OCCOc3ccc4c(c3)C3(SCCS3)c3ccccc3-4)cc1C21SCCS1 |
| InChI | InChI=1S/C32H26O2S4/c1-3-7-27-23(5-1)25-11-9-21(19-29(25)31(27)35-15-16-36-31)33-13-14-34-22-10-12-26-24-6-2-4-8-28(24)32(30(26)20-22)37-17-18-38-32/h1-12,19-20H,13-18H2 |
| InChIKey | BIZKEEZGUOLYHY-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.83 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|