About (3,3-dimethylcyclohexa-1,5-dien-1-yl) diethyl phosphate
(3,3-dimethylcyclohexa-1,5-dien-1-yl) diethyl phosphate (PubChem CID 102268064) has the molecular formula C12H21O4P
and a molecular weight of 260.27 g/mol. Its IUPAC name is (3,3-dimethylcyclohexa-1,5-dien-1-yl) diethyl phosphate.
Molecular Properties
| Compound Name | (3,3-dimethylcyclohexa-1,5-dien-1-yl) diethyl phosphate |
| PubChem CID | 102268064 |
| Molecular Formula | C12H21O4P |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (3,3-dimethylcyclohexa-1,5-dien-1-yl) diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OC1=CC(C)(C)CC=C1 |
| InChI | InChI=1S/C12H21O4P/c1-5-14-17(13,15-6-2)16-11-8-7-9-12(3,4)10-11/h7-8,10H,5-6,9H2,1-4H3 |
| InChIKey | PPOSDENSAVQJCM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3,3-dimethylcyclohexa-1,5-dien-1-yl) diethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-dimethylcyclohexa-1,5-dien-1-yl) diethyl phosphate?
The IUPAC name of (3,3-dimethylcyclohexa-1,5-dien-1-yl) diethyl phosphate (CID 102268064) is (3,3-dimethylcyclohexa-1,5-dien-1-yl) diethyl phosphate.
What is the SMILES notation for (3,3-dimethylcyclohexa-1,5-dien-1-yl) diethyl phosphate?
The canonical SMILES for (3,3-dimethylcyclohexa-1,5-dien-1-yl) diethyl phosphate is CCOP(=O)(OCC)OC1=CC(C)(C)CC=C1.
What is the InChIKey of (3,3-dimethylcyclohexa-1,5-dien-1-yl) diethyl phosphate?
The InChIKey is PPOSDENSAVQJCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21O4P/c1-5-14-17(13,15-6-2)16-11-8-7-9-12(3,4)10-11/h7-8,10H,5-6,9H2,1-4H3.
What are the key properties of (3,3-dimethylcyclohexa-1,5-dien-1-yl) diethyl phosphate?
(3,3-dimethylcyclohexa-1,5-dien-1-yl) diethyl phosphate has a molecular weight of 260.27 g/mol, XLogP of 4.05, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-dimethylcyclohexa-1,5-dien-1-yl) diethyl phosphate is sourced from PubChem (CID 102268064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).