About cis-(2S,3R)-2-(2-methylprop-2-enyl)-3-[tris(phenylsulfanyl)methyl]cyclopentan-1-one
cis-(2S,3R)-2-(2-methylprop-2-enyl)-3-[tris(phenylsulfanyl)methyl]cyclopentan-1-one (PubChem CID 102268198) has the molecular formula C28H28OS3
and a molecular weight of 476.73 g/mol. Its IUPAC name is cis-(2S,3R)-2-(2-methylprop-2-enyl)-3-[tris(phenylsulfanyl)methyl]cyclopentan-1-one.
Molecular Properties
| Compound Name | cis-(2S,3R)-2-(2-methylprop-2-enyl)-3-[tris(phenylsulfanyl)methyl]cyclopentan-1-one |
| PubChem CID | 102268198 |
| Molecular Formula | C28H28OS3 |
| Molecular Weight | 476.73 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | cis-(2S,3R)-2-(2-methylprop-2-enyl)-3-[tris(phenylsulfanyl)methyl]cyclopentan-1-one |
| SMILES | C=C(C)C[C@@H]1C(=O)CC[C@H]1C(Sc1ccccc1)(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C28H28OS3/c1-21(2)20-25-26(18-19-27(25)29)28(30-22-12-6-3-7-13-22,31-23-14-8-4-9-15-23)32-24-16-10-5-11-17-24/h3-17,25-26H,1,18-20H2,2H3/t25-,26+/m0/s1 |
| InChIKey | BQXMSYXPUFMNGG-IZZNHLLZSA-N |
| XLogP | 8.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.73 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cis-(2S,3R)-2-(2-methylprop-2-enyl)-3-[tris(phenylsulfanyl)methyl]cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(2S,3R)-2-(2-methylprop-2-enyl)-3-[tris(phenylsulfanyl)methyl]cyclopentan-1-one?
The IUPAC name of cis-(2S,3R)-2-(2-methylprop-2-enyl)-3-[tris(phenylsulfanyl)methyl]cyclopentan-1-one (CID 102268198) is cis-(2S,3R)-2-(2-methylprop-2-enyl)-3-[tris(phenylsulfanyl)methyl]cyclopentan-1-one.
What is the SMILES notation for cis-(2S,3R)-2-(2-methylprop-2-enyl)-3-[tris(phenylsulfanyl)methyl]cyclopentan-1-one?
The canonical SMILES for cis-(2S,3R)-2-(2-methylprop-2-enyl)-3-[tris(phenylsulfanyl)methyl]cyclopentan-1-one is C=C(C)C[C@@H]1C(=O)CC[C@H]1C(Sc1ccccc1)(Sc1ccccc1)Sc1ccccc1.
What is the InChIKey of cis-(2S,3R)-2-(2-methylprop-2-enyl)-3-[tris(phenylsulfanyl)methyl]cyclopentan-1-one?
The InChIKey is BQXMSYXPUFMNGG-IZZNHLLZSA-N. The full InChI is InChI=1S/C28H28OS3/c1-21(2)20-25-26(18-19-27(25)29)28(30-22-12-6-3-7-13-22,31-23-14-8-4-9-15-23)32-24-16-10-5-11-17-24/h3-17,25-26H,1,18-20H2,2H3/t25-,26+/m0/s1.
What are the key properties of cis-(2S,3R)-2-(2-methylprop-2-enyl)-3-[tris(phenylsulfanyl)methyl]cyclopentan-1-one?
cis-(2S,3R)-2-(2-methylprop-2-enyl)-3-[tris(phenylsulfanyl)methyl]cyclopentan-1-one has a molecular weight of 476.73 g/mol, XLogP of 8.58, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(2S,3R)-2-(2-methylprop-2-enyl)-3-[tris(phenylsulfanyl)methyl]cyclopentan-1-one is sourced from PubChem (CID 102268198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).