C10H4Cl6O2 — CID 102268247
(1R,2S,3R,5R,7R,8S)-1,8,9,10,11,11-hexachloro-4-oxatetracyclo[6.2.1.02,7.03,5]undec-9-en-6-one (PubChem CID 102268247) has the molecular formula C10H4Cl6O2 and a molecular weight of 368.86 g/mol. Its IUPAC name is (1R,2S,3R,5R,7R,8S)-1,8,9,10,11,11-hexachloro-4-oxatetracyclo[6.2.1.02,7.03,5]undec-9-en-6-one.
| Compound Name | (1R,2S,3R,5R,7R,8S)-1,8,9,10,11,11-hexachloro-4-oxatetracyclo[6.2.1.02,7.03,5]undec-9-en-6-one |
|---|---|
| PubChem CID | 102268247 |
| Molecular Formula | C10H4Cl6O2 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 365.83 |
| IUPAC Name | (1R,2S,3R,5R,7R,8S)-1,8,9,10,11,11-hexachloro-4-oxatetracyclo[6.2.1.02,7.03,5]undec-9-en-6-one |
| SMILES | O=C1[C@@H]2O[C@@H]2[C@@H]2[C@H]1[C@]1(Cl)C(Cl)=C(Cl)[C@@]2(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C10H4Cl6O2/c11-6-7(12)9(14)2-1(3(17)5-4(2)18-5)8(6,13)10(9,15)16/h1-2,4-5H/t1-,2+,4-,5+,8+,9-/m1/s1 |
| InChIKey | PBNTYOFNRNQGEM-DBFMOUFMSA-N |
| XLogP | 3.41 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|