C21H13NO2 — CID 102268430
18-hydroxy-2-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(22),3(12),4,6,8,10,13,15,17,20-decaen-19-one (PubChem CID 102268430) has the molecular formula C21H13NO2 and a molecular weight of 311.34 g/mol. Its IUPAC name is 18-hydroxy-2-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(22),3(12),4,6,8,10,13,15,17,20-decaen-19-one.
| Compound Name | 18-hydroxy-2-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(22),3(12),4,6,8,10,13,15,17,20-decaen-19-one |
|---|---|
| PubChem CID | 102268430 |
| Molecular Formula | C21H13NO2 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 18-hydroxy-2-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(22),3(12),4,6,8,10,13,15,17,20-decaen-19-one |
| SMILES | O=c1c(O)ccc2c1ccc1[nH]c3c(ccc4ccccc43)cc12 |
| InChI | InChI=1S/C21H13NO2/c23-19-10-8-15-16(21(19)24)7-9-18-17(15)11-13-6-5-12-3-1-2-4-14(12)20(13)22-18/h1-11,22-23H |
| InChIKey | PCEKZMZUWFBDHK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|