C20H29NO2 — CID 102268567
1-[(2S,4aS,7R,8aS)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]ethanone (PubChem CID 102268567) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 1-[(2S,4aS,7R,8aS)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]ethanone.
| Compound Name | 1-[(2S,4aS,7R,8aS)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]ethanone |
|---|---|
| PubChem CID | 102268567 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 1-[(2S,4aS,7R,8aS)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]ethanone |
| SMILES | CC(=O)[C@@H]1O[C@H]2C[C@H](C)CC[C@H]2C(C)(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H29NO2/c1-14-10-11-17-18(12-14)23-19(15(2)22)21(20(17,3)4)13-16-8-6-5-7-9-16/h5-9,14,17-19H,10-13H2,1-4H3/t14-,17-,18+,19+/m1/s1 |
| InChIKey | UZHIWSIZKPBPDF-OAOYMFHYSA-N |
| XLogP | 4.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |