About (2S)-2-carboxy-3,4-dihydro-2H-pyrrol-5-olate
(2S)-2-carboxy-3,4-dihydro-2H-pyrrol-5-olate (PubChem CID 102268616) has the molecular formula C5H6NO3-
and a molecular weight of 128.11 g/mol. Its IUPAC name is (2S)-2-carboxy-3,4-dihydro-2H-pyrrol-5-olate.
Molecular Properties
| Compound Name | (2S)-2-carboxy-3,4-dihydro-2H-pyrrol-5-olate |
| PubChem CID | 102268616 |
| Molecular Formula | C5H6NO3- |
| Molecular Weight | 128.11 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | (2S)-2-carboxy-3,4-dihydro-2H-pyrrol-5-olate |
| SMILES | O=C(O)[C@@H]1CCC([O-])=N1 |
| InChI | InChI=1S/C5H7NO3/c7-4-2-1-3(6-4)5(8)9/h3H,1-2H2,(H,6,7)(H,8,9)/p-1/t3-/m0/s1 |
| InChIKey | ODHCTXKNWHHXJC-VKHMYHEASA-M |
| XLogP | -1.01 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.11 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-carboxy-3,4-dihydro-2H-pyrrol-5-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-carboxy-3,4-dihydro-2H-pyrrol-5-olate?
The IUPAC name of (2S)-2-carboxy-3,4-dihydro-2H-pyrrol-5-olate (CID 102268616) is (2S)-2-carboxy-3,4-dihydro-2H-pyrrol-5-olate.
What is the SMILES notation for (2S)-2-carboxy-3,4-dihydro-2H-pyrrol-5-olate?
The canonical SMILES for (2S)-2-carboxy-3,4-dihydro-2H-pyrrol-5-olate is O=C(O)[C@@H]1CCC([O-])=N1.
What is the InChIKey of (2S)-2-carboxy-3,4-dihydro-2H-pyrrol-5-olate?
The InChIKey is ODHCTXKNWHHXJC-VKHMYHEASA-M. The full InChI is InChI=1S/C5H7NO3/c7-4-2-1-3(6-4)5(8)9/h3H,1-2H2,(H,6,7)(H,8,9)/p-1/t3-/m0/s1.
What are the key properties of (2S)-2-carboxy-3,4-dihydro-2H-pyrrol-5-olate?
(2S)-2-carboxy-3,4-dihydro-2H-pyrrol-5-olate has a molecular weight of 128.11 g/mol, XLogP of -1.01, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-carboxy-3,4-dihydro-2H-pyrrol-5-olate is sourced from PubChem (CID 102268616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).