C17H21KN2O9S — CID 102268772
potassium 1-[(1S)-1-[(2S,3S)-3-[(1R)-1-hydroxyethyl]-4-oxo-1-sulfoazetidin-2-yl]ethoxy]-N-(2-oxo-2-phenylmethoxyethyl)methanimidate (PubChem CID 102268772) has the molecular formula C17H21KN2O9S and a molecular weight of 468.53 g/mol. Its IUPAC name is potassium 1-[(1S)-1-[(2S,3S)-3-[(1R)-1-hydroxyethyl]-4-oxo-1-sulfoazetidin-2-yl]ethoxy]-N-(2-oxo-2-phenylmethoxyethyl)methanimidate.
| Compound Name | potassium 1-[(1S)-1-[(2S,3S)-3-[(1R)-1-hydroxyethyl]-4-oxo-1-sulfoazetidin-2-yl]ethoxy]-N-(2-oxo-2-phenylmethoxyethyl)methanimidate |
|---|---|
| PubChem CID | 102268772 |
| Molecular Formula | C17H21KN2O9S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | potassium 1-[(1S)-1-[(2S,3S)-3-[(1R)-1-hydroxyethyl]-4-oxo-1-sulfoazetidin-2-yl]ethoxy]-N-(2-oxo-2-phenylmethoxyethyl)methanimidate |
| SMILES | C[C@H](O/C([O-])=N/CC(=O)OCc1ccccc1)[C@@H]1[C@@H]([C@@H](C)O)C(=O)N1S(=O)(=O)O.[K+] |
| InChI | InChI=1S/C17H22N2O9S.K/c1-10(20)14-15(19(16(14)22)29(24,25)26)11(2)28-17(23)18-8-13(21)27-9-12-6-4-3-5-7-12;/h3-7,10-11,14-15,20H,8-9H2,1-2H3,(H,18,23)(H,24,25,26);/q;+1/p-1/t10-,11+,14-,15-;/m1./s1 |
| InChIKey | DLGHAUPHKQQEEE-NWGQJQPPSA-M |
| XLogP | -4.13 |
| TPSA | 165.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | -4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|