About aluminum;2-ethylhexan-1-olate;bis(propan-2-olate)
aluminum;2-ethylhexan-1-olate;bis(propan-2-olate) (PubChem CID 102269268) has the molecular formula C14H31AlO3
and a molecular weight of 274.38 g/mol. Its IUPAC name is aluminum;2-ethylhexan-1-olate;bis(propan-2-olate).
Molecular Properties
| Compound Name | aluminum;2-ethylhexan-1-olate;bis(propan-2-olate) |
| PubChem CID | 102269268 |
| Molecular Formula | C14H31AlO3 |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | aluminum;2-ethylhexan-1-olate;bis(propan-2-olate) |
| SMILES | CC(C)[O-].CC(C)[O-].CCCCC(CC)C[O-].[Al+3] |
| InChI | InChI=1S/C8H17O.2C3H7O.Al/c1-3-5-6-8(4-2)7-9;2*1-3(2)4;/h8H,3-7H2,1-2H3;2*3H,1-2H3;/q3*-1;+3 |
| InChIKey | MRXOPNQJIZJEFV-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze aluminum;2-ethylhexan-1-olate;bis(propan-2-olate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum;2-ethylhexan-1-olate;bis(propan-2-olate)?
The IUPAC name of aluminum;2-ethylhexan-1-olate;bis(propan-2-olate) (CID 102269268) is aluminum;2-ethylhexan-1-olate;bis(propan-2-olate).
What is the SMILES notation for aluminum;2-ethylhexan-1-olate;bis(propan-2-olate)?
The canonical SMILES for aluminum;2-ethylhexan-1-olate;bis(propan-2-olate) is CC(C)[O-].CC(C)[O-].CCCCC(CC)C[O-].[Al+3].
What is the InChIKey of aluminum;2-ethylhexan-1-olate;bis(propan-2-olate)?
The InChIKey is MRXOPNQJIZJEFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17O.2C3H7O.Al/c1-3-5-6-8(4-2)7-9;2*1-3(2)4;/h8H,3-7H2,1-2H3;2*3H,1-2H3;/q3*-1;+3.
What are the key properties of aluminum;2-ethylhexan-1-olate;bis(propan-2-olate)?
aluminum;2-ethylhexan-1-olate;bis(propan-2-olate) has a molecular weight of 274.38 g/mol, XLogP of 0.69, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum;2-ethylhexan-1-olate;bis(propan-2-olate) is sourced from PubChem (CID 102269268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).