C21H25F3N2O6 — CID 102269401
ethyl (2S)-2-[(4S)-2,5-dioxo-4-[4-[(2,2,2-trifluoroacetyl)amino]butyl]-1,3-oxazolidin-3-yl]-4-phenylbutanoate (PubChem CID 102269401) has the molecular formula C21H25F3N2O6 and a molecular weight of 458.43 g/mol. Its IUPAC name is ethyl (2S)-2-[(4S)-2,5-dioxo-4-[4-[(2,2,2-trifluoroacetyl)amino]butyl]-1,3-oxazolidin-3-yl]-4-phenylbutanoate.
| Compound Name | ethyl (2S)-2-[(4S)-2,5-dioxo-4-[4-[(2,2,2-trifluoroacetyl)amino]butyl]-1,3-oxazolidin-3-yl]-4-phenylbutanoate |
|---|---|
| PubChem CID | 102269401 |
| Molecular Formula | C21H25F3N2O6 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | ethyl (2S)-2-[(4S)-2,5-dioxo-4-[4-[(2,2,2-trifluoroacetyl)amino]butyl]-1,3-oxazolidin-3-yl]-4-phenylbutanoate |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N1C(=O)OC(=O)[C@@H]1CCCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C21H25F3N2O6/c1-2-31-17(27)16(12-11-14-8-4-3-5-9-14)26-15(18(28)32-20(26)30)10-6-7-13-25-19(29)21(22,23)24/h3-5,8-9,15-16H,2,6-7,10-13H2,1H3,(H,25,29)/t15-,16-/m0/s1 |
| InChIKey | MFBPXWZWNNBFOR-HOTGVXAUSA-N |
| XLogP | 2.75 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|