C9H11FN2 — CID 102270681
(1E,3E,5Z,7E)-5-fluoro-9-iminonona-1,3,5,7-tetraen-1-amine (PubChem CID 102270681) has the molecular formula C9H11FN2 and a molecular weight of 166.20 g/mol. Its IUPAC name is (1E,3E,5Z,7E)-5-fluoro-9-iminonona-1,3,5,7-tetraen-1-amine.
| Compound Name | (1E,3E,5Z,7E)-5-fluoro-9-iminonona-1,3,5,7-tetraen-1-amine |
|---|---|
| PubChem CID | 102270681 |
| Molecular Formula | C9H11FN2 |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | (1E,3E,5Z,7E)-5-fluoro-9-iminonona-1,3,5,7-tetraen-1-amine |
| SMILES | [H]/N=C/C=C/C=C(F)/C=C/C=C/N |
| InChI | InChI=1S/C9H11FN2/c10-9(5-1-3-7-11)6-2-4-8-12/h1-8,11H,12H2/b3-1+,6-2+,8-4+,9-5-,11-7+ |
| InChIKey | SXBABIHCJTWSTP-STOHIYMNSA-N |
| XLogP | 2.07 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|