C9H10F2N2 — CID 102270683
(1E,3Z,5E,7Z)-3,7-difluoro-9-iminonona-1,3,5,7-tetraen-1-amine (PubChem CID 102270683) has the molecular formula C9H10F2N2 and a molecular weight of 184.19 g/mol. Its IUPAC name is (1E,3Z,5E,7Z)-3,7-difluoro-9-iminonona-1,3,5,7-tetraen-1-amine.
| Compound Name | (1E,3Z,5E,7Z)-3,7-difluoro-9-iminonona-1,3,5,7-tetraen-1-amine |
|---|---|
| PubChem CID | 102270683 |
| Molecular Formula | C9H10F2N2 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | (1E,3Z,5E,7Z)-3,7-difluoro-9-iminonona-1,3,5,7-tetraen-1-amine |
| SMILES | [H]/N=C/C=C(F)/C=C/C=C(F)/C=C/N |
| InChI | InChI=1S/C9H10F2N2/c10-8(4-6-12)2-1-3-9(11)5-7-13/h1-7,12H,13H2/b2-1+,7-5+,8-4-,9-3-,12-6+ |
| InChIKey | XYVTYHSRJOYMQV-PHNLDHQNSA-N |
| XLogP | 2.37 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|