C21H16F6N4O2 — CID 10227079
N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide (PubChem CID 10227079) has the molecular formula C21H16F6N4O2 and a molecular weight of 470.37 g/mol. Its IUPAC name is N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide.
| Compound Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10227079 |
| Molecular Formula | C21H16F6N4O2 |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1)c1cccnc1NCc1ccncc1 |
| InChI | InChI=1S/C21H16F6N4O2/c22-20(23,24)19(33,21(25,26)27)14-3-5-15(6-4-14)31-18(32)16-2-1-9-29-17(16)30-12-13-7-10-28-11-8-13/h1-11,33H,12H2,(H,29,30)(H,31,32) |
| InChIKey | YIDKXOVFDQEFSL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |