C19H38N4O4 — CID 102270866
10-(2-hydroxy-3-octoxypropyl)-1,4,7,10-tetrazacyclododecane-2,6-dione (PubChem CID 102270866) has the molecular formula C19H38N4O4 and a molecular weight of 386.54 g/mol. Its IUPAC name is 10-(2-hydroxy-3-octoxypropyl)-1,4,7,10-tetrazacyclododecane-2,6-dione.
| Compound Name | 10-(2-hydroxy-3-octoxypropyl)-1,4,7,10-tetrazacyclododecane-2,6-dione |
|---|---|
| PubChem CID | 102270866 |
| Molecular Formula | C19H38N4O4 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | 10-(2-hydroxy-3-octoxypropyl)-1,4,7,10-tetrazacyclododecane-2,6-dione |
| SMILES | CCCCCCCCOCC(O)CN1CCNC(=O)CNCC(=O)NCC1 |
| InChI | InChI=1S/C19H38N4O4/c1-2-3-4-5-6-7-12-27-16-17(24)15-23-10-8-21-18(25)13-20-14-19(26)22-9-11-23/h17,20,24H,2-16H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | DUTYPOGXAKGXIG-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|