C24H32O8 — CID 102271577
methyl (2R,5Z)-2-methoxy-2-[(E,2S)-5-methoxycarbonyl-7-oxo-2-prop-1-en-2-yloct-4-enyl]-5-(3-oxobutan-2-ylidene)furan-3-carboxylate (PubChem CID 102271577) has the molecular formula C24H32O8 and a molecular weight of 448.51 g/mol. Its IUPAC name is methyl (2R,5Z)-2-methoxy-2-[(E,2S)-5-methoxycarbonyl-7-oxo-2-prop-1-en-2-yloct-4-enyl]-5-(3-oxobutan-2-ylidene)furan-3-carboxylate.
| Compound Name | methyl (2R,5Z)-2-methoxy-2-[(E,2S)-5-methoxycarbonyl-7-oxo-2-prop-1-en-2-yloct-4-enyl]-5-(3-oxobutan-2-ylidene)furan-3-carboxylate |
|---|---|
| PubChem CID | 102271577 |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | methyl (2R,5Z)-2-methoxy-2-[(E,2S)-5-methoxycarbonyl-7-oxo-2-prop-1-en-2-yloct-4-enyl]-5-(3-oxobutan-2-ylidene)furan-3-carboxylate |
| SMILES | C=C(C)[C@@H](C/C=C(\CC(C)=O)C(=O)OC)C[C@@]1(OC)O/C(=C(/C)C(C)=O)C=C1C(=O)OC |
| InChI | InChI=1S/C24H32O8/c1-14(2)19(10-9-18(11-15(3)25)22(27)29-6)13-24(31-8)20(23(28)30-7)12-21(32-24)16(4)17(5)26/h9,12,19H,1,10-11,13H2,2-8H3/b18-9+,21-16-/t19-,24+/m0/s1 |
| InChIKey | IUQIKFBEJZUNJH-DTLQKNFKSA-N |
| XLogP | 3.37 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|