C26H44O5Si — CID 102271680
diethyl 2-[5,5-dimethyl-3-tri(propan-2-yl)silyloxycyclopent-2-en-1-yl]-2-prop-2-ynylpropanedioate (PubChem CID 102271680) has the molecular formula C26H44O5Si and a molecular weight of 464.72 g/mol. Its IUPAC name is diethyl 2-[5,5-dimethyl-3-tri(propan-2-yl)silyloxycyclopent-2-en-1-yl]-2-prop-2-ynylpropanedioate.
| Compound Name | diethyl 2-[5,5-dimethyl-3-tri(propan-2-yl)silyloxycyclopent-2-en-1-yl]-2-prop-2-ynylpropanedioate |
|---|---|
| PubChem CID | 102271680 |
| Molecular Formula | C26H44O5Si |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | diethyl 2-[5,5-dimethyl-3-tri(propan-2-yl)silyloxycyclopent-2-en-1-yl]-2-prop-2-ynylpropanedioate |
| SMILES | C#CCC(C(=O)OCC)(C(=O)OCC)C1C=C(O[Si](C(C)C)(C(C)C)C(C)C)CC1(C)C |
| InChI | InChI=1S/C26H44O5Si/c1-12-15-26(23(27)29-13-2,24(28)30-14-3)22-16-21(17-25(22,10)11)31-32(18(4)5,19(6)7)20(8)9/h1,16,18-20,22H,13-15,17H2,2-11H3 |
| InChIKey | UFJZUFDKELHJOM-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|