C18H21NO6 — CID 102271976
3-[(2S,5S,6S)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-1-phenylpyrrole-2,5-dione (PubChem CID 102271976) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is 3-[(2S,5S,6S)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-1-phenylpyrrole-2,5-dione.
| Compound Name | 3-[(2S,5S,6S)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-1-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 102271976 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 3-[(2S,5S,6S)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-1-phenylpyrrole-2,5-dione |
| SMILES | CO[C@@]1(C)OC[C@H](C2=CC(=O)N(c3ccccc3)C2=O)O[C@]1(C)OC |
| InChI | InChI=1S/C18H21NO6/c1-17(22-3)18(2,23-4)25-14(11-24-17)13-10-15(20)19(16(13)21)12-8-6-5-7-9-12/h5-10,14H,11H2,1-4H3/t14-,17+,18+/m1/s1 |
| InChIKey | LKSNTNNXXRNLEC-JLSDUUJJSA-N |
| XLogP | 1.63 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|