C14H13NO6 — CID 102271993
methyl (2R,3R)-3-(2,5-dioxo-1-phenylpyrrol-3-yl)-2,3-dihydroxypropanoate (PubChem CID 102271993) has the molecular formula C14H13NO6 and a molecular weight of 291.26 g/mol. Its IUPAC name is methyl (2R,3R)-3-(2,5-dioxo-1-phenylpyrrol-3-yl)-2,3-dihydroxypropanoate.
| Compound Name | methyl (2R,3R)-3-(2,5-dioxo-1-phenylpyrrol-3-yl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 102271993 |
| Molecular Formula | C14H13NO6 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | methyl (2R,3R)-3-(2,5-dioxo-1-phenylpyrrol-3-yl)-2,3-dihydroxypropanoate |
| SMILES | COC(=O)[C@H](O)[C@H](O)C1=CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C14H13NO6/c1-21-14(20)12(18)11(17)9-7-10(16)15(13(9)19)8-5-3-2-4-6-8/h2-7,11-12,17-18H,1H3/t11-,12-/m1/s1 |
| InChIKey | JHYVNCFFHMKCNW-VXGBXAGGSA-N |
| XLogP | -0.62 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|