C22H32N2O — CID 102272059
(3S,6R,8R,10S,11R,15R)-2,2,6-trimethyl-12-phenyl-9-oxa-1,12-diazatetracyclo[8.6.0.03,8.011,15]hexadecane (PubChem CID 102272059) has the molecular formula C22H32N2O and a molecular weight of 340.51 g/mol. Its IUPAC name is (3S,6R,8R,10S,11R,15R)-2,2,6-trimethyl-12-phenyl-9-oxa-1,12-diazatetracyclo[8.6.0.03,8.011,15]hexadecane.
| Compound Name | (3S,6R,8R,10S,11R,15R)-2,2,6-trimethyl-12-phenyl-9-oxa-1,12-diazatetracyclo[8.6.0.03,8.011,15]hexadecane |
|---|---|
| PubChem CID | 102272059 |
| Molecular Formula | C22H32N2O |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | (3S,6R,8R,10S,11R,15R)-2,2,6-trimethyl-12-phenyl-9-oxa-1,12-diazatetracyclo[8.6.0.03,8.011,15]hexadecane |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@H]1[C@H]3[C@H](CCN3c3ccccc3)CN1C2(C)C |
| InChI | InChI=1S/C22H32N2O/c1-15-9-10-18-19(13-15)25-21-20-16(14-24(21)22(18,2)3)11-12-23(20)17-7-5-4-6-8-17/h4-8,15-16,18-21H,9-14H2,1-3H3/t15-,16-,18-,19-,20-,21+/m1/s1 |
| InChIKey | YLNBGEAIYKUVML-VJQWSGFBSA-N |
| XLogP | 4.14 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |