About 6-[3-(1-adamantyl)-4-(2,3-dihydroxypropoxy)phenyl]naphthalene-2-carboxylic acid
6-[3-(1-adamantyl)-4-(2,3-dihydroxypropoxy)phenyl]naphthalene-2-carboxylic acid (PubChem CID 10227224) has the molecular formula C30H32O5
and a molecular weight of 472.58 g/mol. Its IUPAC name is 6-[3-(1-adamantyl)-4-(2,3-dihydroxypropoxy)phenyl]naphthalene-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-[3-(1-adamantyl)-4-(2,3-dihydroxypropoxy)phenyl]naphthalene-2-carboxylic acid |
| PubChem CID | 10227224 |
| Molecular Formula | C30H32O5 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 6-[3-(1-adamantyl)-4-(2,3-dihydroxypropoxy)phenyl]naphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2cc(-c3ccc(OCC(O)CO)c(C45CC6CC(CC(C6)C4)C5)c3)ccc2c1 |
| InChI | InChI=1S/C30H32O5/c31-16-26(32)17-35-28-6-5-24(22-1-2-23-11-25(29(33)34)4-3-21(23)10-22)12-27(28)30-13-18-7-19(14-30)9-20(8-18)15-30/h1-6,10-12,18-20,26,31-32H,7-9,13-17H2,(H,33,34) |
| InChIKey | HCGLZXMFTPFYBB-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[3-(1-adamantyl)-4-(2,3-dihydroxypropoxy)phenyl]naphthalene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(1-adamantyl)-4-(2,3-dihydroxypropoxy)phenyl]naphthalene-2-carboxylic acid?
The IUPAC name of 6-[3-(1-adamantyl)-4-(2,3-dihydroxypropoxy)phenyl]naphthalene-2-carboxylic acid (CID 10227224) is 6-[3-(1-adamantyl)-4-(2,3-dihydroxypropoxy)phenyl]naphthalene-2-carboxylic acid.
What is the SMILES notation for 6-[3-(1-adamantyl)-4-(2,3-dihydroxypropoxy)phenyl]naphthalene-2-carboxylic acid?
The canonical SMILES for 6-[3-(1-adamantyl)-4-(2,3-dihydroxypropoxy)phenyl]naphthalene-2-carboxylic acid is O=C(O)c1ccc2cc(-c3ccc(OCC(O)CO)c(C45CC6CC(CC(C6)C4)C5)c3)ccc2c1.
What is the InChIKey of 6-[3-(1-adamantyl)-4-(2,3-dihydroxypropoxy)phenyl]naphthalene-2-carboxylic acid?
The InChIKey is HCGLZXMFTPFYBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H32O5/c31-16-26(32)17-35-28-6-5-24(22-1-2-23-11-25(29(33)34)4-3-21(23)10-22)12-27(28)30-13-18-7-19(14-30)9-20(8-18)15-30/h1-6,10-12,18-20,26,31-32H,7-9,13-17H2,(H,33,34).
What are the key properties of 6-[3-(1-adamantyl)-4-(2,3-dihydroxypropoxy)phenyl]naphthalene-2-carboxylic acid?
6-[3-(1-adamantyl)-4-(2,3-dihydroxypropoxy)phenyl]naphthalene-2-carboxylic acid has a molecular weight of 472.58 g/mol, XLogP of 5.40, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(1-adamantyl)-4-(2,3-dihydroxypropoxy)phenyl]naphthalene-2-carboxylic acid is sourced from PubChem (CID 10227224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).