C24H32O6Si — CID 102272427
6-[(3aS,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]naphthalene-1,4-dione (PubChem CID 102272427) has the molecular formula C24H32O6Si and a molecular weight of 444.60 g/mol. Its IUPAC name is 6-[(3aS,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]naphthalene-1,4-dione.
| Compound Name | 6-[(3aS,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 102272427 |
| Molecular Formula | C24H32O6Si |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 6-[(3aS,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]naphthalene-1,4-dione |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H]2c1ccc2c(c1)C(=O)C=CC2=O |
| InChI | InChI=1S/C24H32O6Si/c1-23(2,3)31(6,7)27-13-19-21-22(30-24(4,5)29-21)20(28-19)14-8-9-15-16(12-14)18(26)11-10-17(15)25/h8-12,19-22H,13H2,1-7H3/t19-,20-,21-,22+/m1/s1 |
| InChIKey | LHKLFSRXIFXTPV-YSFYHYPLSA-N |
| XLogP | 4.60 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|