C14H16O5 — CID 102272538
1-[(2S,3S,4R,5S)-3,4-dihydroxy-1,10-dioxaspiro[4.5]decan-2-yl]hexa-2,4-diyn-1-one (PubChem CID 102272538) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is 1-[(2S,3S,4R,5S)-3,4-dihydroxy-1,10-dioxaspiro[4.5]decan-2-yl]hexa-2,4-diyn-1-one.
| Compound Name | 1-[(2S,3S,4R,5S)-3,4-dihydroxy-1,10-dioxaspiro[4.5]decan-2-yl]hexa-2,4-diyn-1-one |
|---|---|
| PubChem CID | 102272538 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 1-[(2S,3S,4R,5S)-3,4-dihydroxy-1,10-dioxaspiro[4.5]decan-2-yl]hexa-2,4-diyn-1-one |
| SMILES | CC#CC#CC(=O)[C@H]1O[C@@]2(CCCCO2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H16O5/c1-2-3-4-7-10(15)12-11(16)13(17)14(19-12)8-5-6-9-18-14/h11-13,16-17H,5-6,8-9H2,1H3/t11-,12-,13-,14+/m1/s1 |
| InChIKey | BUQOYNRNNNQXHE-SYQHCUMBSA-N |
| XLogP | -0.40 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|