C18H19BN2 — CID 102272586
1,3-diethyl-2-(2-phenylethynyl)-1,3,2-benzodiazaborole (PubChem CID 102272586) has the molecular formula C18H19BN2 and a molecular weight of 274.18 g/mol. Its IUPAC name is 1,3-diethyl-2-(2-phenylethynyl)-1,3,2-benzodiazaborole.
| Compound Name | 1,3-diethyl-2-(2-phenylethynyl)-1,3,2-benzodiazaborole |
|---|---|
| PubChem CID | 102272586 |
| Molecular Formula | C18H19BN2 |
| Molecular Weight | 274.18 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 1,3-diethyl-2-(2-phenylethynyl)-1,3,2-benzodiazaborole |
| SMILES | CCN1B(C#Cc2ccccc2)N(CC)c2ccccc21 |
| InChI | InChI=1S/C18H19BN2/c1-3-20-17-12-8-9-13-18(17)21(4-2)19(20)15-14-16-10-6-5-7-11-16/h5-13H,3-4H2,1-2H3 |
| InChIKey | DWUKCWIJBMRCIM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.18 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|