About (2E,4E)-4-methyl-1-prop-2-ynoxyhexa-2,4-diene
(2E,4E)-4-methyl-1-prop-2-ynoxyhexa-2,4-diene (PubChem CID 102272970) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is (2E,4E)-4-methyl-1-prop-2-ynoxyhexa-2,4-diene.
Molecular Properties
| Compound Name | (2E,4E)-4-methyl-1-prop-2-ynoxyhexa-2,4-diene |
| PubChem CID | 102272970 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (2E,4E)-4-methyl-1-prop-2-ynoxyhexa-2,4-diene |
| SMILES | C#CCOC/C=C/C(C)=C/C |
| InChI | InChI=1S/C10H14O/c1-4-8-11-9-6-7-10(3)5-2/h1,5-7H,8-9H2,2-3H3/b7-6+,10-5+ |
| InChIKey | IFLNGYDOPSWCAP-XYLIHAQWSA-N |
| XLogP | 2.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-4-methyl-1-prop-2-ynoxyhexa-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-4-methyl-1-prop-2-ynoxyhexa-2,4-diene?
The IUPAC name of (2E,4E)-4-methyl-1-prop-2-ynoxyhexa-2,4-diene (CID 102272970) is (2E,4E)-4-methyl-1-prop-2-ynoxyhexa-2,4-diene.
What is the SMILES notation for (2E,4E)-4-methyl-1-prop-2-ynoxyhexa-2,4-diene?
The canonical SMILES for (2E,4E)-4-methyl-1-prop-2-ynoxyhexa-2,4-diene is C#CCOC/C=C/C(C)=C/C.
What is the InChIKey of (2E,4E)-4-methyl-1-prop-2-ynoxyhexa-2,4-diene?
The InChIKey is IFLNGYDOPSWCAP-XYLIHAQWSA-N. The full InChI is InChI=1S/C10H14O/c1-4-8-11-9-6-7-10(3)5-2/h1,5-7H,8-9H2,2-3H3/b7-6+,10-5+.
What are the key properties of (2E,4E)-4-methyl-1-prop-2-ynoxyhexa-2,4-diene?
(2E,4E)-4-methyl-1-prop-2-ynoxyhexa-2,4-diene has a molecular weight of 150.22 g/mol, XLogP of 2.16, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-4-methyl-1-prop-2-ynoxyhexa-2,4-diene is sourced from PubChem (CID 102272970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).