C18H16O8S2 — CID 102273428
dimethyl (5Z)-5-(2-methoxy-2-oxoethylidene)-2,4-dithiophen-2-yl-1,3-dioxolane-2,4-dicarboxylate (PubChem CID 102273428) has the molecular formula C18H16O8S2 and a molecular weight of 424.45 g/mol. Its IUPAC name is dimethyl (5Z)-5-(2-methoxy-2-oxoethylidene)-2,4-dithiophen-2-yl-1,3-dioxolane-2,4-dicarboxylate.
| Compound Name | dimethyl (5Z)-5-(2-methoxy-2-oxoethylidene)-2,4-dithiophen-2-yl-1,3-dioxolane-2,4-dicarboxylate |
|---|---|
| PubChem CID | 102273428 |
| Molecular Formula | C18H16O8S2 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | dimethyl (5Z)-5-(2-methoxy-2-oxoethylidene)-2,4-dithiophen-2-yl-1,3-dioxolane-2,4-dicarboxylate |
| SMILES | COC(=O)/C=C1\OC(C(=O)OC)(c2cccs2)OC1(C(=O)OC)c1cccs1 |
| InChI | InChI=1S/C18H16O8S2/c1-22-14(19)10-11-17(15(20)23-2,12-6-4-8-27-12)26-18(25-11,16(21)24-3)13-7-5-9-28-13/h4-10H,1-3H3/b11-10- |
| InChIKey | BLQLYKCLVFBODE-KHPPLWFESA-N |
| XLogP | 2.31 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|