About 6,7-dimethoxy-2-methyl-1-phenyliminoisoquinoline-3,4-dione
6,7-dimethoxy-2-methyl-1-phenyliminoisoquinoline-3,4-dione (PubChem CID 102273986) has the molecular formula C18H16N2O4
and a molecular weight of 324.34 g/mol. Its IUPAC name is 6,7-dimethoxy-2-methyl-1-phenyliminoisoquinoline-3,4-dione.
Molecular Properties
| Compound Name | 6,7-dimethoxy-2-methyl-1-phenyliminoisoquinoline-3,4-dione |
| PubChem CID | 102273986 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 6,7-dimethoxy-2-methyl-1-phenyliminoisoquinoline-3,4-dione |
| SMILES | COc1cc2c(cc1OC)/C(=N/c1ccccc1)N(C)C(=O)C2=O |
| InChI | InChI=1S/C18H16N2O4/c1-20-17(19-11-7-5-4-6-8-11)13-10-15(24-3)14(23-2)9-12(13)16(21)18(20)22/h4-10H,1-3H3/b19-17- |
| InChIKey | NLTUYHZJOSKBNP-ZPHPHTNESA-N |
| XLogP | 2.44 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dimethoxy-2-methyl-1-phenyliminoisoquinoline-3,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-2-methyl-1-phenyliminoisoquinoline-3,4-dione?
The IUPAC name of 6,7-dimethoxy-2-methyl-1-phenyliminoisoquinoline-3,4-dione (CID 102273986) is 6,7-dimethoxy-2-methyl-1-phenyliminoisoquinoline-3,4-dione.
What is the SMILES notation for 6,7-dimethoxy-2-methyl-1-phenyliminoisoquinoline-3,4-dione?
The canonical SMILES for 6,7-dimethoxy-2-methyl-1-phenyliminoisoquinoline-3,4-dione is COc1cc2c(cc1OC)/C(=N/c1ccccc1)N(C)C(=O)C2=O.
What is the InChIKey of 6,7-dimethoxy-2-methyl-1-phenyliminoisoquinoline-3,4-dione?
The InChIKey is NLTUYHZJOSKBNP-ZPHPHTNESA-N. The full InChI is InChI=1S/C18H16N2O4/c1-20-17(19-11-7-5-4-6-8-11)13-10-15(24-3)14(23-2)9-12(13)16(21)18(20)22/h4-10H,1-3H3/b19-17-.
What are the key properties of 6,7-dimethoxy-2-methyl-1-phenyliminoisoquinoline-3,4-dione?
6,7-dimethoxy-2-methyl-1-phenyliminoisoquinoline-3,4-dione has a molecular weight of 324.34 g/mol, XLogP of 2.44, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-2-methyl-1-phenyliminoisoquinoline-3,4-dione is sourced from PubChem (CID 102273986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).