C11H14O3 — CID 102274849
(3aS,5aR,9aS)-3,3a,4,5a,6,7,8,9-octahydroindeno[3,3a-c]furan-1,5-dione (PubChem CID 102274849) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is (3aS,5aR,9aS)-3,3a,4,5a,6,7,8,9-octahydroindeno[3,3a-c]furan-1,5-dione.
| Compound Name | (3aS,5aR,9aS)-3,3a,4,5a,6,7,8,9-octahydroindeno[3,3a-c]furan-1,5-dione |
|---|---|
| PubChem CID | 102274849 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (3aS,5aR,9aS)-3,3a,4,5a,6,7,8,9-octahydroindeno[3,3a-c]furan-1,5-dione |
| SMILES | O=C1C[C@@H]2COC(=O)[C@@]23CCCC[C@@H]13 |
| InChI | InChI=1S/C11H14O3/c12-9-5-7-6-14-10(13)11(7)4-2-1-3-8(9)11/h7-8H,1-6H2/t7-,8+,11+/m1/s1 |
| InChIKey | GRZYBKKCOCVVIQ-FYBVGQRMSA-N |
| XLogP | 1.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |