C36H38N2O6S12 — CID 102274930
bis[2-(5,8,11-trioxa-2,14,16,18-tetrathiabicyclo[13.3.0]octadec-1(15)-en-17-ylidene)-1,3-benzodithiol-5-yl]diazene (PubChem CID 102274930) has the molecular formula C36H38N2O6S12 and a molecular weight of 979.51 g/mol. Its IUPAC name is bis[2-(5,8,11-trioxa-2,14,16,18-tetrathiabicyclo[13.3.0]octadec-1(15)-en-17-ylidene)-1,3-benzodithiol-5-yl]diazene.
| Compound Name | bis[2-(5,8,11-trioxa-2,14,16,18-tetrathiabicyclo[13.3.0]octadec-1(15)-en-17-ylidene)-1,3-benzodithiol-5-yl]diazene |
|---|---|
| PubChem CID | 102274930 |
| Molecular Formula | C36H38N2O6S12 |
| Molecular Weight | 979.51 g/mol |
| Exact Mass | 977.94 |
| IUPAC Name | bis[2-(5,8,11-trioxa-2,14,16,18-tetrathiabicyclo[13.3.0]octadec-1(15)-en-17-ylidene)-1,3-benzodithiol-5-yl]diazene |
| SMILES | c1cc2c(cc1/N=N/c1ccc3c(c1)SC(=C1SC4=C(SCCOCCOCCOCCS4)S1)S3)SC(=C1SC3=C(SCCOCCOCCOCCS3)S1)S2 |
| InChI | InChI=1S/C36H38N2O6S12/c1-3-25-27(51-33(49-25)35-53-29-30(54-35)46-18-14-42-10-6-39-5-9-41-13-17-45-29)21-23(1)37-38-24-2-4-26-28(22-24)52-34(50-26)36-55-31-32(56-36)48-20-16-44-12-8-40-7-11-43-15-19-47-31/h1-4,21-22H,5-20H2/b38-37+ |
| InChIKey | JPJPUTFAUBOAGD-HEFFKOSUSA-N |
| XLogP | 13.02 |
| TPSA | 80.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 979.51 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|