C21H36O3Si — CID 102275142
(3aS,5aS,9aR,9bS)-9a-[[tert-butyl(dimethyl)silyl]oxymethyl]-7,9b-dimethyl-3,3a,4,5a,8,9-hexahydro-1H-cyclopenta[c]chromen-2-one (PubChem CID 102275142) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is (3aS,5aS,9aR,9bS)-9a-[[tert-butyl(dimethyl)silyl]oxymethyl]-7,9b-dimethyl-3,3a,4,5a,8,9-hexahydro-1H-cyclopenta[c]chromen-2-one.
| Compound Name | (3aS,5aS,9aR,9bS)-9a-[[tert-butyl(dimethyl)silyl]oxymethyl]-7,9b-dimethyl-3,3a,4,5a,8,9-hexahydro-1H-cyclopenta[c]chromen-2-one |
|---|---|
| PubChem CID | 102275142 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | (3aS,5aS,9aR,9bS)-9a-[[tert-butyl(dimethyl)silyl]oxymethyl]-7,9b-dimethyl-3,3a,4,5a,8,9-hexahydro-1H-cyclopenta[c]chromen-2-one |
| SMILES | CC1=C[C@@H]2OC[C@H]3CC(=O)C[C@]3(C)[C@@]2(CO[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C21H36O3Si/c1-15-8-9-21(14-24-25(6,7)19(2,3)4)18(10-15)23-13-16-11-17(22)12-20(16,21)5/h10,16,18H,8-9,11-14H2,1-7H3/t16-,18+,20+,21-/m1/s1 |
| InChIKey | QGFHLLSKKFYTGA-GKBFQHABSA-N |
| XLogP | 5.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|