C20H10F8O4 — CID 102275443
bis[(2,3,4,5-tetrafluorophenyl)methyl] (2Z,4Z)-hexa-2,4-dienedioate (PubChem CID 102275443) has the molecular formula C20H10F8O4 and a molecular weight of 466.28 g/mol. Its IUPAC name is bis[(2,3,4,5-tetrafluorophenyl)methyl] (2Z,4Z)-hexa-2,4-dienedioate.
| Compound Name | bis[(2,3,4,5-tetrafluorophenyl)methyl] (2Z,4Z)-hexa-2,4-dienedioate |
|---|---|
| PubChem CID | 102275443 |
| Molecular Formula | C20H10F8O4 |
| Molecular Weight | 466.28 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | bis[(2,3,4,5-tetrafluorophenyl)methyl] (2Z,4Z)-hexa-2,4-dienedioate |
| SMILES | O=C(/C=C\C=C/C(=O)OCc1cc(F)c(F)c(F)c1F)OCc1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H10F8O4/c21-11-5-9(15(23)19(27)17(11)25)7-31-13(29)3-1-2-4-14(30)32-8-10-6-12(22)18(26)20(28)16(10)24/h1-6H,7-8H2/b3-1-,4-2- |
| InChIKey | DPDZXNPUBJTOOU-CCAGOZQPSA-N |
| XLogP | 4.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.28 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|