C30H39N3O7 — CID 102275536
tert-butyl (2S,3S)-2-cyano-2-[[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-methylamino]-3-(nitromethyl)-4-phenylmethoxybutanoate (PubChem CID 102275536) has the molecular formula C30H39N3O7 and a molecular weight of 553.66 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-cyano-2-[[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-methylamino]-3-(nitromethyl)-4-phenylmethoxybutanoate.
| Compound Name | tert-butyl (2S,3S)-2-cyano-2-[[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-methylamino]-3-(nitromethyl)-4-phenylmethoxybutanoate |
|---|---|
| PubChem CID | 102275536 |
| Molecular Formula | C30H39N3O7 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | tert-butyl (2S,3S)-2-cyano-2-[[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-methylamino]-3-(nitromethyl)-4-phenylmethoxybutanoate |
| SMILES | CN([C@H]1COC(C)(C)O[C@H]1c1ccccc1)[C@@](C#N)(C(=O)OC(C)(C)C)[C@@H](COCc1ccccc1)C[N+](=O)[O-] |
| InChI | InChI=1S/C30H39N3O7/c1-28(2,3)40-27(34)30(21-31,24(17-33(35)36)19-37-18-22-13-9-7-10-14-22)32(6)25-20-38-29(4,5)39-26(25)23-15-11-8-12-16-23/h7-16,24-26H,17-20H2,1-6H3/t24-,25+,26+,30-/m1/s1 |
| InChIKey | SWJDFOGSHNLSII-NHICWYPXSA-N |
| XLogP | 4.52 |
| TPSA | 124.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|