About 18-hydroxy-17-methyl-16-azabicyclo[12.3.1]octadeca-1(17),14(18)-dien-15-one
18-hydroxy-17-methyl-16-azabicyclo[12.3.1]octadeca-1(17),14(18)-dien-15-one (PubChem CID 102275952) has the molecular formula C18H29NO2
and a molecular weight of 291.43 g/mol. Its IUPAC name is 18-hydroxy-17-methyl-16-azabicyclo[12.3.1]octadeca-1(17),14(18)-dien-15-one.
Molecular Properties
| Compound Name | 18-hydroxy-17-methyl-16-azabicyclo[12.3.1]octadeca-1(17),14(18)-dien-15-one |
| PubChem CID | 102275952 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.43 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 18-hydroxy-17-methyl-16-azabicyclo[12.3.1]octadeca-1(17),14(18)-dien-15-one |
| SMILES | Cc1[nH]c(=O)c2c(O)c1CCCCCCCCCCCC2 |
| InChI | InChI=1S/C18H29NO2/c1-14-15-12-10-8-6-4-2-3-5-7-9-11-13-16(17(15)20)18(21)19-14/h2-13H2,1H3,(H2,19,20,21) |
| InChIKey | LWBOLYFOBDRRMM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 18-hydroxy-17-methyl-16-azabicyclo[12.3.1]octadeca-1(17),14(18)-dien-15-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 18-hydroxy-17-methyl-16-azabicyclo[12.3.1]octadeca-1(17),14(18)-dien-15-one?
The IUPAC name of 18-hydroxy-17-methyl-16-azabicyclo[12.3.1]octadeca-1(17),14(18)-dien-15-one (CID 102275952) is 18-hydroxy-17-methyl-16-azabicyclo[12.3.1]octadeca-1(17),14(18)-dien-15-one.
What is the SMILES notation for 18-hydroxy-17-methyl-16-azabicyclo[12.3.1]octadeca-1(17),14(18)-dien-15-one?
The canonical SMILES for 18-hydroxy-17-methyl-16-azabicyclo[12.3.1]octadeca-1(17),14(18)-dien-15-one is Cc1[nH]c(=O)c2c(O)c1CCCCCCCCCCCC2.
What is the InChIKey of 18-hydroxy-17-methyl-16-azabicyclo[12.3.1]octadeca-1(17),14(18)-dien-15-one?
The InChIKey is LWBOLYFOBDRRMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO2/c1-14-15-12-10-8-6-4-2-3-5-7-9-11-13-16(17(15)20)18(21)19-14/h2-13H2,1H3,(H2,19,20,21).
What are the key properties of 18-hydroxy-17-methyl-16-azabicyclo[12.3.1]octadeca-1(17),14(18)-dien-15-one?
18-hydroxy-17-methyl-16-azabicyclo[12.3.1]octadeca-1(17),14(18)-dien-15-one has a molecular weight of 291.43 g/mol, XLogP of 4.39, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 18-hydroxy-17-methyl-16-azabicyclo[12.3.1]octadeca-1(17),14(18)-dien-15-one is sourced from PubChem (CID 102275952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).