C19H38O6Si — CID 102276965
(4S,5S)-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethoxyethyl]-2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-ol (PubChem CID 102276965) has the molecular formula C19H38O6Si and a molecular weight of 390.59 g/mol. Its IUPAC name is (4S,5S)-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethoxyethyl]-2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-ol.
| Compound Name | (4S,5S)-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethoxyethyl]-2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-ol |
|---|---|
| PubChem CID | 102276965 |
| Molecular Formula | C19H38O6Si |
| Molecular Weight | 390.59 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (4S,5S)-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethoxyethyl]-2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-ol |
| SMILES | C=CC[C@]1(O)COC(C)(C)O[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C(OC)OC |
| InChI | InChI=1S/C19H38O6Si/c1-11-12-19(20)13-23-18(5,6)24-15(19)14(16(21-7)22-8)25-26(9,10)17(2,3)4/h11,14-16,20H,1,12-13H2,2-10H3/t14-,15+,19+/m1/s1 |
| InChIKey | ILTFTQZWBDDOLP-VCBZYWHSSA-N |
| XLogP | 3.45 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.59 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|