C30H22N6 — CID 102277390
1-N,1-N,5-N,5-N-tetrapyridin-2-ylnaphthalene-1,5-diamine (PubChem CID 102277390) has the molecular formula C30H22N6 and a molecular weight of 466.55 g/mol. Its IUPAC name is 1-N,1-N,5-N,5-N-tetrapyridin-2-ylnaphthalene-1,5-diamine.
| Compound Name | 1-N,1-N,5-N,5-N-tetrapyridin-2-ylnaphthalene-1,5-diamine |
|---|---|
| PubChem CID | 102277390 |
| Molecular Formula | C30H22N6 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 1-N,1-N,5-N,5-N-tetrapyridin-2-ylnaphthalene-1,5-diamine |
| SMILES | c1ccc(N(c2ccccn2)c2cccc3c(N(c4ccccn4)c4ccccn4)cccc23)nc1 |
| InChI | InChI=1S/C30H22N6/c1-5-19-31-27(15-1)35(28-16-2-6-20-32-28)25-13-9-12-24-23(25)11-10-14-26(24)36(29-17-3-7-21-33-29)30-18-4-8-22-34-30/h1-22H |
| InChIKey | QRUUCXQATQDPJR-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |