About 2-phenyl-1,4-dipyrrolidin-1-ylbutane-1,4-dione
2-phenyl-1,4-dipyrrolidin-1-ylbutane-1,4-dione (PubChem CID 102277835) has the molecular formula C18H24N2O2
and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-phenyl-1,4-dipyrrolidin-1-ylbutane-1,4-dione.
Molecular Properties
| Compound Name | 2-phenyl-1,4-dipyrrolidin-1-ylbutane-1,4-dione |
| PubChem CID | 102277835 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 2-phenyl-1,4-dipyrrolidin-1-ylbutane-1,4-dione |
| SMILES | O=C(CC(C(=O)N1CCCC1)c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C18H24N2O2/c21-17(19-10-4-5-11-19)14-16(15-8-2-1-3-9-15)18(22)20-12-6-7-13-20/h1-3,8-9,16H,4-7,10-14H2 |
| InChIKey | QLYIYHDOJLIBQL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenyl-1,4-dipyrrolidin-1-ylbutane-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-1,4-dipyrrolidin-1-ylbutane-1,4-dione?
The IUPAC name of 2-phenyl-1,4-dipyrrolidin-1-ylbutane-1,4-dione (CID 102277835) is 2-phenyl-1,4-dipyrrolidin-1-ylbutane-1,4-dione.
What is the SMILES notation for 2-phenyl-1,4-dipyrrolidin-1-ylbutane-1,4-dione?
The canonical SMILES for 2-phenyl-1,4-dipyrrolidin-1-ylbutane-1,4-dione is O=C(CC(C(=O)N1CCCC1)c1ccccc1)N1CCCC1.
What is the InChIKey of 2-phenyl-1,4-dipyrrolidin-1-ylbutane-1,4-dione?
The InChIKey is QLYIYHDOJLIBQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O2/c21-17(19-10-4-5-11-19)14-16(15-8-2-1-3-9-15)18(22)20-12-6-7-13-20/h1-3,8-9,16H,4-7,10-14H2.
What are the key properties of 2-phenyl-1,4-dipyrrolidin-1-ylbutane-1,4-dione?
2-phenyl-1,4-dipyrrolidin-1-ylbutane-1,4-dione has a molecular weight of 300.40 g/mol, XLogP of 2.41, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-1,4-dipyrrolidin-1-ylbutane-1,4-dione is sourced from PubChem (CID 102277835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).