C24H31NO4Si — CID 102277910
[(3aR,4R,6aS)-2,2-dimethyl-5-oxido-4,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-5-ium-4-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 102277910) has the molecular formula C24H31NO4Si and a molecular weight of 425.60 g/mol. Its IUPAC name is [(3aR,4R,6aS)-2,2-dimethyl-5-oxido-4,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-5-ium-4-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aR,4R,6aS)-2,2-dimethyl-5-oxido-4,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-5-ium-4-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 102277910 |
| Molecular Formula | C24H31NO4Si |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | [(3aR,4R,6aS)-2,2-dimethyl-5-oxido-4,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-5-ium-4-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC1(C)O[C@H]2[C@H](C=[N+]([O-])[C@@H]2CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C24H31NO4Si/c1-23(2,3)30(18-12-8-6-9-13-18,19-14-10-7-11-15-19)27-17-20-22-21(16-25(20)26)28-24(4,5)29-22/h6-16,20-22H,17H2,1-5H3/t20-,21+,22-/m1/s1 |
| InChIKey | YOQRBVIUSDZMLF-BHIFYINESA-N |
| XLogP | 3.05 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|