C14H20O6 — CID 102277917
6,6-dimethyl-2-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]-5,7-dihydro-1-benzofuran-4-one (PubChem CID 102277917) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is 6,6-dimethyl-2-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]-5,7-dihydro-1-benzofuran-4-one.
| Compound Name | 6,6-dimethyl-2-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]-5,7-dihydro-1-benzofuran-4-one |
|---|---|
| PubChem CID | 102277917 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 6,6-dimethyl-2-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]-5,7-dihydro-1-benzofuran-4-one |
| SMILES | CC1(C)CC(=O)c2cc([C@@H](O)[C@H](O)[C@H](O)CO)oc2C1 |
| InChI | InChI=1S/C14H20O6/c1-14(2)4-8(16)7-3-10(20-11(7)5-14)13(19)12(18)9(17)6-15/h3,9,12-13,15,17-19H,4-6H2,1-2H3/t9-,12-,13-/m1/s1 |
| InChIKey | WFXNYPTZWIFVNN-OASPWFOLSA-N |
| XLogP | 0.18 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |