C23H16BrFN2O2S — CID 10227832
6-[3-(3-bromophenyl)prop-1-ynyl]-3-[(3-fluorophenyl)methyl]-1-methylthieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 10227832) has the molecular formula C23H16BrFN2O2S and a molecular weight of 483.36 g/mol. Its IUPAC name is 6-[3-(3-bromophenyl)prop-1-ynyl]-3-[(3-fluorophenyl)methyl]-1-methylthieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 6-[3-(3-bromophenyl)prop-1-ynyl]-3-[(3-fluorophenyl)methyl]-1-methylthieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10227832 |
| Molecular Formula | C23H16BrFN2O2S |
| Molecular Weight | 483.36 g/mol |
| Exact Mass | 482.01 |
| IUPAC Name | 6-[3-(3-bromophenyl)prop-1-ynyl]-3-[(3-fluorophenyl)methyl]-1-methylthieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)n(Cc2cccc(F)c2)c(=O)c2cc(C#CCc3cccc(Br)c3)sc21 |
| InChI | InChI=1S/C23H16BrFN2O2S/c1-26-22-20(13-19(30-22)10-4-6-15-5-2-8-17(24)11-15)21(28)27(23(26)29)14-16-7-3-9-18(25)12-16/h2-3,5,7-9,11-13H,6,14H2,1H3 |
| InChIKey | DASUIPWYFGLHGQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|