C51H57N3O3Se3 — CID 102278404
7,15,23-trimethyl-3,11,19-tris(2-phenylselanylethyl)-3,11,19-triazatetracyclo[19.3.1.15,9.113,17]heptacosa-1(24),5,7,9(27),13(26),14,16,21(25),22-nonaene-25,26,27-triol (PubChem CID 102278404) has the molecular formula C51H57N3O3Se3 and a molecular weight of 996.91 g/mol. Its IUPAC name is 7,15,23-trimethyl-3,11,19-tris(2-phenylselanylethyl)-3,11,19-triazatetracyclo[19.3.1.15,9.113,17]heptacosa-1(24),5,7,9(27),13(26),14,16,21(25),22-nonaene-25,26,27-triol.
| Compound Name | 7,15,23-trimethyl-3,11,19-tris(2-phenylselanylethyl)-3,11,19-triazatetracyclo[19.3.1.15,9.113,17]heptacosa-1(24),5,7,9(27),13(26),14,16,21(25),22-nonaene-25,26,27-triol |
|---|---|
| PubChem CID | 102278404 |
| Molecular Formula | C51H57N3O3Se3 |
| Molecular Weight | 996.91 g/mol |
| Exact Mass | 999.19 |
| IUPAC Name | 7,15,23-trimethyl-3,11,19-tris(2-phenylselanylethyl)-3,11,19-triazatetracyclo[19.3.1.15,9.113,17]heptacosa-1(24),5,7,9(27),13(26),14,16,21(25),22-nonaene-25,26,27-triol |
| SMILES | Cc1cc2c(O)c(c1)CN(CC[Se]c1ccccc1)Cc1cc(C)cc(c1O)CN(CC[Se]c1ccccc1)Cc1cc(C)cc(c1O)CN(CC[Se]c1ccccc1)C2 |
| InChI | InChI=1S/C51H57N3O3Se3/c1-37-25-40-31-52(19-22-58-46-13-7-4-8-14-46)33-42-27-38(2)29-44(50(42)56)35-54(21-24-60-48-17-11-6-12-18-48)36-45-30-39(3)28-43(51(45)57)34-53(32-41(26-37)49(40)55)20-23-59-47-15-9-5-10-16-47/h4-18,25-30,55-57H,19-24,31-36H2,1-3H3 |
| InChIKey | ANXSCUDLEPGYNF-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 70.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 996.91 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|