C30H63N3O12S3Si3 — CID 102278883
1-[3,5-bis[3-(3-trimethoxysilylpropylsulfanyl)propanoyl]-1,3,5-triazinan-1-yl]-3-(3-trimethoxysilylpropylsulfanyl)propan-1-one (PubChem CID 102278883) has the molecular formula C30H63N3O12S3Si3 and a molecular weight of 838.30 g/mol. Its IUPAC name is 1-[3,5-bis[3-(3-trimethoxysilylpropylsulfanyl)propanoyl]-1,3,5-triazinan-1-yl]-3-(3-trimethoxysilylpropylsulfanyl)propan-1-one.
| Compound Name | 1-[3,5-bis[3-(3-trimethoxysilylpropylsulfanyl)propanoyl]-1,3,5-triazinan-1-yl]-3-(3-trimethoxysilylpropylsulfanyl)propan-1-one |
|---|---|
| PubChem CID | 102278883 |
| Molecular Formula | C30H63N3O12S3Si3 |
| Molecular Weight | 838.30 g/mol |
| Exact Mass | 837.29 |
| IUPAC Name | 1-[3,5-bis[3-(3-trimethoxysilylpropylsulfanyl)propanoyl]-1,3,5-triazinan-1-yl]-3-(3-trimethoxysilylpropylsulfanyl)propan-1-one |
| SMILES | CO[Si](CCCSCCC(=O)N1CN(C(=O)CCSCCC[Si](OC)(OC)OC)CN(C(=O)CCSCCC[Si](OC)(OC)OC)C1)(OC)OC |
| InChI | InChI=1S/C30H63N3O12S3Si3/c1-37-49(38-2,39-3)22-10-16-46-19-13-28(34)31-25-32(29(35)14-20-47-17-11-23-50(40-4,41-5)42-6)27-33(26-31)30(36)15-21-48-18-12-24-51(43-7,44-8)45-9/h10-27H2,1-9H3 |
| InChIKey | PSRQZHCLYPZDGW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 144.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|