C12H15FO5 — CID 102278924
methyl (1R,2S,4R)-5-fluoro-8,8-dimethoxy-7-oxobicyclo[2.2.2]oct-5-ene-2-carboxylate (PubChem CID 102278924) has the molecular formula C12H15FO5 and a molecular weight of 258.24 g/mol. Its IUPAC name is methyl (1R,2S,4R)-5-fluoro-8,8-dimethoxy-7-oxobicyclo[2.2.2]oct-5-ene-2-carboxylate.
| Compound Name | methyl (1R,2S,4R)-5-fluoro-8,8-dimethoxy-7-oxobicyclo[2.2.2]oct-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 102278924 |
| Molecular Formula | C12H15FO5 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | methyl (1R,2S,4R)-5-fluoro-8,8-dimethoxy-7-oxobicyclo[2.2.2]oct-5-ene-2-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@H]2C(F)=C[C@@H]1C(=O)C2(OC)OC |
| InChI | InChI=1S/C12H15FO5/c1-16-11(15)7-4-8-9(13)5-6(7)10(14)12(8,17-2)18-3/h5-8H,4H2,1-3H3/t6-,7-,8-/m0/s1 |
| InChIKey | UPVCXRTYDQRNAW-FXQIFTODSA-N |
| XLogP | 0.84 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|