C19H28O8 — CID 102279092
methyl 2-[(1S,3R,7S,10R,12S,14R,15S,17R)-14-hydroxy-12,14-dimethyl-5-oxo-2,6,11,16-tetraoxatetracyclo[8.8.0.03,7.012,17]octadecan-15-yl]acetate (PubChem CID 102279092) has the molecular formula C19H28O8 and a molecular weight of 384.43 g/mol. Its IUPAC name is methyl 2-[(1S,3R,7S,10R,12S,14R,15S,17R)-14-hydroxy-12,14-dimethyl-5-oxo-2,6,11,16-tetraoxatetracyclo[8.8.0.03,7.012,17]octadecan-15-yl]acetate.
| Compound Name | methyl 2-[(1S,3R,7S,10R,12S,14R,15S,17R)-14-hydroxy-12,14-dimethyl-5-oxo-2,6,11,16-tetraoxatetracyclo[8.8.0.03,7.012,17]octadecan-15-yl]acetate |
|---|---|
| PubChem CID | 102279092 |
| Molecular Formula | C19H28O8 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | methyl 2-[(1S,3R,7S,10R,12S,14R,15S,17R)-14-hydroxy-12,14-dimethyl-5-oxo-2,6,11,16-tetraoxatetracyclo[8.8.0.03,7.012,17]octadecan-15-yl]acetate |
| SMILES | COC(=O)C[C@@H]1O[C@@H]2C[C@@H]3O[C@@H]4CC(=O)O[C@H]4CC[C@H]3O[C@@]2(C)C[C@@]1(C)O |
| InChI | InChI=1S/C19H28O8/c1-18(22)9-19(2)15(26-14(18)8-16(20)23-3)6-12-11(27-19)5-4-10-13(24-12)7-17(21)25-10/h10-15,22H,4-9H2,1-3H3/t10-,11+,12-,13+,14-,15+,18+,19-/m0/s1 |
| InChIKey | VIXDJANKAZIUIT-DMXXTZNLSA-N |
| XLogP | 0.87 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |