C29H40O6 — CID 10227919
2-(5-hydroxy-4,4-dimethylpentyl)-6-[3-[5-(5-hydroxy-4,4-dimethylpentyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]propyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 10227919) has the molecular formula C29H40O6 and a molecular weight of 484.63 g/mol. Its IUPAC name is 2-(5-hydroxy-4,4-dimethylpentyl)-6-[3-[5-(5-hydroxy-4,4-dimethylpentyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]propyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(5-hydroxy-4,4-dimethylpentyl)-6-[3-[5-(5-hydroxy-4,4-dimethylpentyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]propyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 10227919 |
| Molecular Formula | C29H40O6 |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | 2-(5-hydroxy-4,4-dimethylpentyl)-6-[3-[5-(5-hydroxy-4,4-dimethylpentyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]propyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(C)(CO)CCCC1=CC(=O)C=C(CCCC2=CC(=O)C=C(CCCC(C)(C)CO)C2=O)C1=O |
| InChI | InChI=1S/C29H40O6/c1-28(2,18-30)12-6-10-22-16-24(32)14-20(26(22)34)8-5-9-21-15-25(33)17-23(27(21)35)11-7-13-29(3,4)19-31/h14-17,30-31H,5-13,18-19H2,1-4H3 |
| InChIKey | CMWGCYPVUBKAJV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|