C26H21NO4 — CID 102279837
(6S,6aS,9R,10R,10aS)-10-nitro-6,9-diphenyl-6a,9,10,10a-tetrahydro-6H-benzo[c]chromene-8-carbaldehyde (PubChem CID 102279837) has the molecular formula C26H21NO4 and a molecular weight of 411.46 g/mol. Its IUPAC name is (6S,6aS,9R,10R,10aS)-10-nitro-6,9-diphenyl-6a,9,10,10a-tetrahydro-6H-benzo[c]chromene-8-carbaldehyde.
| Compound Name | (6S,6aS,9R,10R,10aS)-10-nitro-6,9-diphenyl-6a,9,10,10a-tetrahydro-6H-benzo[c]chromene-8-carbaldehyde |
|---|---|
| PubChem CID | 102279837 |
| Molecular Formula | C26H21NO4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | (6S,6aS,9R,10R,10aS)-10-nitro-6,9-diphenyl-6a,9,10,10a-tetrahydro-6H-benzo[c]chromene-8-carbaldehyde |
| SMILES | O=CC1=C[C@H]2[C@@H](c3ccccc3O[C@@H]2c2ccccc2)[C@@H]([N+](=O)[O-])[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C26H21NO4/c28-16-19-15-21-24(25(27(29)30)23(19)17-9-3-1-4-10-17)20-13-7-8-14-22(20)31-26(21)18-11-5-2-6-12-18/h1-16,21,23-26H/t21-,23+,24+,25-,26+/m0/s1 |
| InChIKey | CMFJYCFLBTUQSS-OJGLOBPSSA-N |
| XLogP | 5.09 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|