C28H25NO4 — CID 102279839
(6S,6aS,9R,10R,10aS)-6,9-bis(2-methylphenyl)-10-nitro-6a,9,10,10a-tetrahydro-6H-benzo[c]chromene-8-carbaldehyde (PubChem CID 102279839) has the molecular formula C28H25NO4 and a molecular weight of 439.51 g/mol. Its IUPAC name is (6S,6aS,9R,10R,10aS)-6,9-bis(2-methylphenyl)-10-nitro-6a,9,10,10a-tetrahydro-6H-benzo[c]chromene-8-carbaldehyde.
| Compound Name | (6S,6aS,9R,10R,10aS)-6,9-bis(2-methylphenyl)-10-nitro-6a,9,10,10a-tetrahydro-6H-benzo[c]chromene-8-carbaldehyde |
|---|---|
| PubChem CID | 102279839 |
| Molecular Formula | C28H25NO4 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | (6S,6aS,9R,10R,10aS)-6,9-bis(2-methylphenyl)-10-nitro-6a,9,10,10a-tetrahydro-6H-benzo[c]chromene-8-carbaldehyde |
| SMILES | Cc1ccccc1[C@H]1Oc2ccccc2[C@@H]2[C@@H]1C=C(C=O)[C@@H](c1ccccc1C)[C@@H]2[N+](=O)[O-] |
| InChI | InChI=1S/C28H25NO4/c1-17-9-3-5-11-20(17)25-19(16-30)15-23-26(27(25)29(31)32)22-13-7-8-14-24(22)33-28(23)21-12-6-4-10-18(21)2/h3-16,23,25-28H,1-2H3/t23-,25-,26+,27-,28+/m0/s1 |
| InChIKey | KCUFXPLJCYYNIP-HKFGFSCZSA-N |
| XLogP | 5.70 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|