C18H28O2 — CID 102280110
5-but-2-ynyl-5-(5,5-dimethylhexa-2,3-dienyl)-2,2-dimethyl-1,3-dioxane (PubChem CID 102280110) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 5-but-2-ynyl-5-(5,5-dimethylhexa-2,3-dienyl)-2,2-dimethyl-1,3-dioxane.
| Compound Name | 5-but-2-ynyl-5-(5,5-dimethylhexa-2,3-dienyl)-2,2-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 102280110 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 5-but-2-ynyl-5-(5,5-dimethylhexa-2,3-dienyl)-2,2-dimethyl-1,3-dioxane |
| SMILES | CC#CCC1(CC=C=CC(C)(C)C)COC(C)(C)OC1 |
| InChI | InChI=1S/C18H28O2/c1-7-8-12-18(13-10-9-11-16(2,3)4)14-19-17(5,6)20-15-18/h10-11H,12-15H2,1-6H3 |
| InChIKey | GPBQDTTVRRVGFF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|