C14H22O3 — CID 102280140
methyl (7E)-4,4,7-trimethyl-3-oxodeca-7,9-dienoate (PubChem CID 102280140) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is methyl (7E)-4,4,7-trimethyl-3-oxodeca-7,9-dienoate.
| Compound Name | methyl (7E)-4,4,7-trimethyl-3-oxodeca-7,9-dienoate |
|---|---|
| PubChem CID | 102280140 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | methyl (7E)-4,4,7-trimethyl-3-oxodeca-7,9-dienoate |
| SMILES | C=C/C=C(\C)CCC(C)(C)C(=O)CC(=O)OC |
| InChI | InChI=1S/C14H22O3/c1-6-7-11(2)8-9-14(3,4)12(15)10-13(16)17-5/h6-7H,1,8-10H2,2-5H3/b11-7+ |
| InChIKey | RFDDEIKMJHSVCP-YRNVUSSQSA-N |
| XLogP | 3.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|